C23H24BrN3O2 — CID 99885870
5-bromo-N-[(E)-[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 99885870) has the molecular formula C23H24BrN3O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 5-bromo-N-[(E)-[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 99885870 |
| Molecular Formula | C23H24BrN3O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 5-bromo-N-[(E)-[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | C[C@H]1CC(C)(C)N(C)c2ccc(/C=N/NC(=O)c3cc4cc(Br)ccc4o3)cc21 |
| InChI | InChI=1S/C23H24BrN3O2/c1-14-12-23(2,3)27(4)19-7-5-15(9-18(14)19)13-25-26-22(28)21-11-16-10-17(24)6-8-20(16)29-21/h5-11,13-14H,12H2,1-4H3,(H,26,28)/b25-13+/t14-/m0/s1 |
| InChIKey | MIQRYHIRPVGYQB-XHCMJAMOSA-N |
| XLogP | 5.68 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|