C25H28BrN3O2 — CID 50860776
5-bromo-N-[(E)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 50860776) has the molecular formula C25H28BrN3O2 and a molecular weight of 482.42 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50860776 |
| Molecular Formula | C25H28BrN3O2 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 5-bromo-N-[(E)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCN1c2cc(C)c(/C=N/NC(=O)c3cc4cc(Br)ccc4o3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H28BrN3O2/c1-6-29-21-9-15(2)18(11-20(21)16(3)13-25(29,4)5)14-27-28-24(30)23-12-17-10-19(26)7-8-22(17)31-23/h7-12,14,16H,6,13H2,1-5H3,(H,28,30)/b27-14+ |
| InChIKey | LDBHKNFQZFGJDA-MZJWZYIUSA-N |
| XLogP | 6.38 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|