C24H26BrN3O2 — CID 133170414
5-bromo-N-[(Z)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 133170414) has the molecular formula C24H26BrN3O2 and a molecular weight of 468.40 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 133170414 |
| Molecular Formula | C24H26BrN3O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 5-bromo-N-[(Z)-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCN1c2ccc(/C=N\NC(=O)c3cc4cc(Br)ccc4o3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H26BrN3O2/c1-5-28-20-8-6-16(10-19(20)15(2)13-24(28,3)4)14-26-27-23(29)22-12-17-11-18(25)7-9-21(17)30-22/h6-12,14-15H,5,13H2,1-4H3,(H,27,29)/b26-14- |
| InChIKey | ICSIGGDDAKLXFG-WGARJPEWSA-N |
| XLogP | 6.07 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|