C24H30ClN3O2S — CID 50861202
N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide (PubChem CID 50861202) has the molecular formula C24H30ClN3O2S and a molecular weight of 460.04 g/mol. Its IUPAC name is N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide.
| Compound Name | N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 50861202 |
| Molecular Formula | C24H30ClN3O2S |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide |
| SMILES | CCN1c2cc(Cl)c(/C=N/NC(=O)CSc3ccc(OC)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H30ClN3O2S/c1-6-28-22-12-21(25)17(11-20(22)16(2)13-24(28,3)4)14-26-27-23(29)15-31-19-9-7-18(30-5)8-10-19/h7-12,14,16H,6,13,15H2,1-5H3,(H,27,29)/b26-14+ |
| InChIKey | FMFPMXVBRWKKIO-VULFUBBASA-N |
| XLogP | 5.70 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|