C24H30FN3O — CID 50863699
N-[4-[(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide (PubChem CID 50863699) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is N-[4-[(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide.
| Compound Name | N-[4-[(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide |
|---|---|
| PubChem CID | 50863699 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[4-[(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide |
| SMILES | CCCN1c2cc(F)c(/C=N/c3ccc(NC(C)=O)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H30FN3O/c1-6-11-28-23-13-22(25)18(12-21(23)16(2)14-24(28,4)5)15-26-19-7-9-20(10-8-19)27-17(3)29/h7-10,12-13,15-16H,6,11,14H2,1-5H3,(H,27,29)/b26-15+ |
| InChIKey | QECDCEIHWYSCAA-CVKSISIWSA-N |
| XLogP | 6.04 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|