C23H29FN2 — CID 50861559
1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-ethylphenyl)methanimine (PubChem CID 50861559) has the molecular formula C23H29FN2 and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-ethylphenyl)methanimine.
| Compound Name | 1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 50861559 |
| Molecular Formula | C23H29FN2 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-ethylphenyl)methanimine |
| SMILES | CCc1ccc(/N=C/c2cc3c(cc2F)N(CC)C(C)(C)CC3C)cc1 |
| InChI | InChI=1S/C23H29FN2/c1-6-17-8-10-19(11-9-17)25-15-18-12-20-16(3)14-23(4,5)26(7-2)22(20)13-21(18)24/h8-13,15-16H,6-7,14H2,1-5H3/b25-15+ |
| InChIKey | BUKKWKCFBJVKQH-MFKUBSTISA-N |
| XLogP | 6.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|