C22H26F2N2 — CID 50863534
N-(4-fluorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50863534) has the molecular formula C22H26F2N2 and a molecular weight of 356.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(4-fluorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50863534 |
| Molecular Formula | C22H26F2N2 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-(4-fluorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(F)c(/C=N/c3ccc(F)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H26F2N2/c1-5-10-26-21-12-20(24)16(11-19(21)15(2)13-22(26,3)4)14-25-18-8-6-17(23)7-9-18/h6-9,11-12,14-15H,5,10,13H2,1-4H3/b25-14+ |
| InChIKey | VGQHHHJVCPYNHS-AFUMVMLFSA-N |
| XLogP | 6.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|