C25H34FN3 — CID 50861679
N,N-diethyl-4-[(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline (PubChem CID 50861679) has the molecular formula C25H34FN3 and a molecular weight of 395.57 g/mol. Its IUPAC name is N,N-diethyl-4-[(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline.
| Compound Name | N,N-diethyl-4-[(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50861679 |
| Molecular Formula | C25H34FN3 |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | N,N-diethyl-4-[(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline |
| SMILES | CCN(CC)c1ccc(/N=C/c2cc3c(cc2F)N(CC)C(C)(C)CC3C)cc1 |
| InChI | InChI=1S/C25H34FN3/c1-7-28(8-2)21-12-10-20(11-13-21)27-17-19-14-22-18(4)16-25(5,6)29(9-3)24(22)15-23(19)26/h10-15,17-18H,7-9,16H2,1-6H3/b27-17+ |
| InChIKey | CVUNJTGYLVKOBM-WPWMEQJKSA-N |
| XLogP | 6.53 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|