C22H26FN3O2 — CID 50861582
1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-methyl-3-nitrophenyl)methanimine (PubChem CID 50861582) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-methyl-3-nitrophenyl)methanimine.
| Compound Name | 1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-methyl-3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 50861582 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-methyl-3-nitrophenyl)methanimine |
| SMILES | CCN1c2cc(F)c(/C=N/c3ccc(C)c([N+](=O)[O-])c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H26FN3O2/c1-6-25-21-11-19(23)16(9-18(21)15(3)12-22(25,4)5)13-24-17-8-7-14(2)20(10-17)26(27)28/h7-11,13,15H,6,12H2,1-5H3/b24-13+ |
| InChIKey | DLIGDSPZYYWXBO-ZMOGYAJESA-N |
| XLogP | 5.91 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|