C21H24FN5O4 — CID 50861333
N-[(Z)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2,4-dinitroaniline (PubChem CID 50861333) has the molecular formula C21H24FN5O4 and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 50861333 |
| Molecular Formula | C21H24FN5O4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[(Z)-(1-ethyl-7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2,4-dinitroaniline |
| SMILES | CCN1c2cc(F)c(/C=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2C(C)CC1(C)C |
| InChI | InChI=1S/C21H24FN5O4/c1-5-25-19-10-17(22)14(8-16(19)13(2)11-21(25,3)4)12-23-24-18-7-6-15(26(28)29)9-20(18)27(30)31/h6-10,12-13,24H,5,11H2,1-4H3/b23-12- |
| InChIKey | MXGOXTQCMYQGFQ-FMCGGJTJSA-N |
| XLogP | 5.20 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|