C22H28N4O2 — CID 124649276
N-[(Z)-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-nitroaniline (PubChem CID 124649276) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[(Z)-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[(Z)-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 124649276 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-[(Z)-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-nitroaniline |
| SMILES | CCN1c2cc(C)c(/C=N\Nc3ccc([N+](=O)[O-])cc3)cc2[C@H](C)CC1(C)C |
| InChI | InChI=1S/C22H28N4O2/c1-6-25-21-11-15(2)17(12-20(21)16(3)13-22(25,4)5)14-23-24-18-7-9-19(10-8-18)26(27)28/h7-12,14,16,24H,6,13H2,1-5H3/b23-14-/t16-/m1/s1 |
| InChIKey | VWSKMUAPYWVBST-GMPVXANTSA-N |
| XLogP | 5.46 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|