C20H25N5O2 — CID 99885793
5-nitro-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridin-2-amine (PubChem CID 99885793) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-nitro-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridin-2-amine.
| Compound Name | 5-nitro-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 99885793 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-nitro-N-[(Z)-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridin-2-amine |
| SMILES | Cc1cc2c(cc1/C=N\Nc1ccc([N+](=O)[O-])cn1)[C@@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C20H25N5O2/c1-13-8-18-17(14(2)10-20(3,4)24(18)5)9-15(13)11-22-23-19-7-6-16(12-21-19)25(26)27/h6-9,11-12,14H,10H2,1-5H3,(H,21,23)/b22-11-/t14-/m0/s1 |
| InChIKey | HKLFZLJSSRJNCN-YTWQSXOVSA-N |
| XLogP | 4.47 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|