C20H25N5O3 — CID 50859785
N-[(Z)-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-5-nitropyridin-2-amine (PubChem CID 50859785) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(Z)-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-5-nitropyridin-2-amine.
| Compound Name | N-[(Z)-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 50859785 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[(Z)-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-5-nitropyridin-2-amine |
| SMILES | COc1cc2c(cc1/C=N\Nc1ccc([N+](=O)[O-])cn1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C20H25N5O3/c1-13-10-20(2,3)24(4)17-9-18(28-5)14(8-16(13)17)11-22-23-19-7-6-15(12-21-19)25(26)27/h6-9,11-13H,10H2,1-5H3,(H,21,23)/b22-11- |
| InChIKey | RHPNOJDKMZOGBF-JJFYIABZSA-N |
| XLogP | 4.17 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|