C17H26N4S — CID 50860564
[(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea (PubChem CID 50860564) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is [(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea.
| Compound Name | [(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 50860564 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(Z)-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]thiourea |
| SMILES | CCN1c2cc(C)c(/C=N\NC(N)=S)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C17H26N4S/c1-6-21-15-7-11(2)13(10-19-20-16(18)22)8-14(15)12(3)9-17(21,4)5/h7-8,10,12H,6,9H2,1-5H3,(H3,18,20,22)/b19-10- |
| InChIKey | JOQHVWQLDSVGTO-GRSHGNNSSA-N |
| XLogP | 3.27 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|