C28H31FN2 — CID 50863707
1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(4-phenylphenyl)methanimine (PubChem CID 50863707) has the molecular formula C28H31FN2 and a molecular weight of 414.57 g/mol. Its IUPAC name is 1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(4-phenylphenyl)methanimine.
| Compound Name | 1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(4-phenylphenyl)methanimine |
|---|---|
| PubChem CID | 50863707 |
| Molecular Formula | C28H31FN2 |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(4-phenylphenyl)methanimine |
| SMILES | CCCN1c2cc(F)c(/C=N/c3ccc(-c4ccccc4)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H31FN2/c1-5-15-31-27-17-26(29)23(16-25(27)20(2)18-28(31,3)4)19-30-24-13-11-22(12-14-24)21-9-7-6-8-10-21/h6-14,16-17,19-20H,5,15,18H2,1-4H3/b30-19+ |
| InChIKey | SEUSCDMXQWRFKF-NDZAJKAJSA-N |
| XLogP | 7.75 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|