C22H25Cl2FN2 — CID 50863596
N-(2,4-dichlorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50863596) has the molecular formula C22H25Cl2FN2 and a molecular weight of 407.36 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2,4-dichlorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50863596 |
| Molecular Formula | C22H25Cl2FN2 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(F)c(/C=N/c3ccc(Cl)cc3Cl)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H25Cl2FN2/c1-5-8-27-21-11-19(25)15(9-17(21)14(2)12-22(27,3)4)13-26-20-7-6-16(23)10-18(20)24/h6-7,9-11,13-14H,5,8,12H2,1-4H3/b26-13+ |
| InChIKey | RTDJJNXWKFSRLA-LGJNPRDNSA-N |
| XLogP | 7.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|