C26H26ClN3O2S — CID 50859255
1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-[4-(4-nitrophenyl)sulfanylphenyl]methanimine (PubChem CID 50859255) has the molecular formula C26H26ClN3O2S and a molecular weight of 480.03 g/mol. Its IUPAC name is 1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-[4-(4-nitrophenyl)sulfanylphenyl]methanimine.
| Compound Name | 1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-[4-(4-nitrophenyl)sulfanylphenyl]methanimine |
|---|---|
| PubChem CID | 50859255 |
| Molecular Formula | C26H26ClN3O2S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-N-[4-(4-nitrophenyl)sulfanylphenyl]methanimine |
| SMILES | CC1CC(C)(C)N(C)c2cc(Cl)c(/C=N/c3ccc(Sc4ccc([N+](=O)[O-])cc4)cc3)cc21 |
| InChI | InChI=1S/C26H26ClN3O2S/c1-17-15-26(2,3)29(4)25-14-24(27)18(13-23(17)25)16-28-19-5-9-21(10-6-19)33-22-11-7-20(8-12-22)30(31)32/h5-14,16-17H,15H2,1-4H3/b28-16+ |
| InChIKey | JRZAQIQUWVWFFQ-LQKURTRISA-N |
| XLogP | 7.87 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|