C22H27ClN2O2 — CID 50861788
5-chloro-2-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenol (PubChem CID 50861788) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 5-chloro-2-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenol.
| Compound Name | 5-chloro-2-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenol |
|---|---|
| PubChem CID | 50861788 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 5-chloro-2-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenol |
| SMILES | CCN1c2cc(OC)c(/C=N/c3ccc(Cl)cc3O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H27ClN2O2/c1-6-25-19-11-21(27-5)15(9-17(19)14(2)12-22(25,3)4)13-24-18-8-7-16(23)10-20(18)26/h7-11,13-14,26H,6,12H2,1-5H3/b24-13+ |
| InChIKey | QXWPAAKKCUNZAC-ZMOGYAJESA-N |
| XLogP | 5.92 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|