C22H27IN2O — CID 50861593
1-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-iodophenyl)methanimine (PubChem CID 50861593) has the molecular formula C22H27IN2O and a molecular weight of 462.38 g/mol. Its IUPAC name is 1-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-iodophenyl)methanimine.
| Compound Name | 1-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-iodophenyl)methanimine |
|---|---|
| PubChem CID | 50861593 |
| Molecular Formula | C22H27IN2O |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1-(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-iodophenyl)methanimine |
| SMILES | CCN1c2cc(OC)c(/C=N/c3cccc(I)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H27IN2O/c1-6-25-20-12-21(26-5)16(10-19(20)15(2)13-22(25,3)4)14-24-18-9-7-8-17(23)11-18/h7-12,14-15H,6,13H2,1-5H3/b24-14+ |
| InChIKey | WNSJMCHGDGGFTL-ZVHZXABRSA-N |
| XLogP | 6.16 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|