C21H26N2S — CID 50858602
N-(2-methylsulfanylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50858602) has the molecular formula C21H26N2S and a molecular weight of 338.52 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2-methylsulfanylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50858602 |
| Molecular Formula | C21H26N2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CSc1ccccc1/N=C/c1ccc2c(c1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C21H26N2S/c1-15-13-21(2,3)23(4)19-11-10-16(12-17(15)19)14-22-18-8-6-7-9-20(18)24-5/h6-12,14-15H,13H2,1-5H3/b22-14+ |
| InChIKey | GANDDFULVWWQML-HYARGMPZSA-N |
| XLogP | 5.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|