C22H27ClN2 — CID 50862687
N-(2-chlorophenyl)-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50862687) has the molecular formula C22H27ClN2 and a molecular weight of 354.93 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2-chlorophenyl)-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50862687 |
| Molecular Formula | C22H27ClN2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-(2-chlorophenyl)-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CCCN1c2ccc(/C=N/c3ccccc3Cl)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H27ClN2/c1-5-12-25-21-11-10-17(13-18(21)16(2)14-22(25,3)4)15-24-20-9-7-6-8-19(20)23/h6-11,13,15-16H,5,12,14H2,1-4H3/b24-15+ |
| InChIKey | XKQYFLDWXWKZRG-BUVRLJJBSA-N |
| XLogP | 6.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|