C28H31ClN2O — CID 50862266
N-[4-(3-chlorophenoxy)phenyl]-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50862266) has the molecular formula C28H31ClN2O and a molecular weight of 447.02 g/mol. Its IUPAC name is N-[4-(3-chlorophenoxy)phenyl]-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-[4-(3-chlorophenoxy)phenyl]-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50862266 |
| Molecular Formula | C28H31ClN2O |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[4-(3-chlorophenoxy)phenyl]-1-(2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CCCN1c2ccc(/C=N/c3ccc(Oc4cccc(Cl)c4)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H31ClN2O/c1-5-15-31-27-14-9-21(16-26(27)20(2)18-28(31,3)4)19-30-23-10-12-24(13-11-23)32-25-8-6-7-22(29)17-25/h6-14,16-17,19-20H,5,15,18H2,1-4H3/b30-19+ |
| InChIKey | QIQTXGOSXVDDFH-NDZAJKAJSA-N |
| XLogP | 8.39 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|