C28H32N2O2 — CID 99865717
1-[(4S)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine (PubChem CID 99865717) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-[(4S)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine.
| Compound Name | 1-[(4S)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 99865717 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-[(4S)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]-N-[4-(4-methoxyphenoxy)phenyl]methanimine |
| SMILES | CCN1c2ccc(/C=N/c3ccc(Oc4ccc(OC)cc4)cc3)cc2[C@@H](C)CC1(C)C |
| InChI | InChI=1S/C28H32N2O2/c1-6-30-27-16-7-21(17-26(27)20(2)18-28(30,3)4)19-29-22-8-10-24(11-9-22)32-25-14-12-23(31-5)13-15-25/h7-17,19-20H,6,18H2,1-5H3/b29-19+/t20-/m0/s1 |
| InChIKey | KMFOPKYSPKYMHP-ZUSSYJGPSA-N |
| XLogP | 7.35 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|