C21H27N3O — CID 50860421
1-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(6-methoxy-3-pyridinyl)methanimine (PubChem CID 50860421) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(6-methoxy-3-pyridinyl)methanimine.
| Compound Name | 1-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(6-methoxy-3-pyridinyl)methanimine |
|---|---|
| PubChem CID | 50860421 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(6-methoxy-3-pyridinyl)methanimine |
| SMILES | CCN1c2ccc(/C=N/c3ccc(OC)nc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C21H27N3O/c1-6-24-19-9-7-16(11-18(19)15(2)12-21(24,3)4)13-22-17-8-10-20(25-5)23-14-17/h7-11,13-15H,6,12H2,1-5H3/b22-13+ |
| InChIKey | XCONEAGXVAWXDN-LPYMAVHISA-N |
| XLogP | 4.95 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|