C21H25FN2 — CID 50858542
N-(4-fluoro-3-methylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50858542) has the molecular formula C21H25FN2 and a molecular weight of 324.44 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(4-fluoro-3-methylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50858542 |
| Molecular Formula | C21H25FN2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | Cc1cc(/N=C/c2ccc3c(c2)C(C)CC(C)(C)N3C)ccc1F |
| InChI | InChI=1S/C21H25FN2/c1-14-10-17(7-8-19(14)22)23-13-16-6-9-20-18(11-16)15(2)12-21(3,4)24(20)5/h6-11,13,15H,12H2,1-5H3/b23-13+ |
| InChIKey | HBSCRFMCSPTXGP-YDZHTSKRSA-N |
| XLogP | 5.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|