C18H18ClFN2 — CID 4589321
N-(4-chlorophenyl)-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine (PubChem CID 4589321) has the molecular formula C18H18ClFN2 and a molecular weight of 316.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine.
| Compound Name | N-(4-chlorophenyl)-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 4589321 |
| Molecular Formula | C18H18ClFN2 |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-(4-chlorophenyl)-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine |
| SMILES | Cc1cc(N2CCCC2)c(F)cc1/C=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClFN2/c1-13-10-18(22-8-2-3-9-22)17(20)11-14(13)12-21-16-6-4-15(19)5-7-16/h4-7,10-12H,2-3,8-9H2,1H3/b21-12+ |
| InChIKey | ARPBUIWVNIRPID-CIAFOILYSA-N |
| XLogP | 5.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|