C18H20FN3 — CID 3899831
N-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]aniline (PubChem CID 3899831) has the molecular formula C18H20FN3 and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]aniline.
| Compound Name | N-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 3899831 |
| Molecular Formula | C18H20FN3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]aniline |
| SMILES | Cc1cc(N2CCCC2)c(F)cc1C=NNc1ccccc1 |
| InChI | InChI=1S/C18H20FN3/c1-14-11-18(22-9-5-6-10-22)17(19)12-15(14)13-20-21-16-7-3-2-4-8-16/h2-4,7-8,11-13,21H,5-6,9-10H2,1H3 |
| InChIKey | KSWSSXQEWQUJQT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|