C24H22ClFN2O — CID 3612589
N-[4-(2-chlorophenoxy)phenyl]-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine (PubChem CID 3612589) has the molecular formula C24H22ClFN2O and a molecular weight of 408.90 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)phenyl]-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine.
| Compound Name | N-[4-(2-chlorophenoxy)phenyl]-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 3612589 |
| Molecular Formula | C24H22ClFN2O |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[4-(2-chlorophenoxy)phenyl]-1-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methanimine |
| SMILES | Cc1cc(N2CCCC2)c(F)cc1/C=N/c1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H22ClFN2O/c1-17-14-23(28-12-4-5-13-28)22(26)15-18(17)16-27-19-8-10-20(11-9-19)29-24-7-3-2-6-21(24)25/h2-3,6-11,14-16H,4-5,12-13H2,1H3/b27-16+ |
| InChIKey | VMIZIHGVXSFMMN-JVWAILMASA-N |
| XLogP | 6.93 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|