About 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine
1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine (PubChem CID 126111922) has the molecular formula C26H28N2O4
and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine.
Molecular Properties
| Compound Name | 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine |
| PubChem CID | 126111922 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1/C=N/c1ccc(Oc2ccccc2OC)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-29-23-8-4-5-9-24(23)32-21-12-10-20(11-13-21)27-18-19-16-26(31-3)22(17-25(19)30-2)28-14-6-7-15-28/h4-5,8-13,16-18H,6-7,14-15H2,1-3H3/b27-18+ |
| InChIKey | LJAWHBNMKRODRD-OVVQPSECSA-N |
| XLogP | 5.86 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine?
The IUPAC name of 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine (CID 126111922) is 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine.
What is the SMILES notation for 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine?
The canonical SMILES for 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine is COc1cc(N2CCCC2)c(OC)cc1/C=N/c1ccc(Oc2ccccc2OC)cc1.
What is the InChIKey of 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine?
The InChIKey is LJAWHBNMKRODRD-OVVQPSECSA-N. The full InChI is InChI=1S/C26H28N2O4/c1-29-23-8-4-5-9-24(23)32-21-12-10-20(11-13-21)27-18-19-16-26(31-3)22(17-25(19)30-2)28-14-6-7-15-28/h4-5,8-13,16-18H,6-7,14-15H2,1-3H3/b27-18+.
What are the key properties of 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine?
1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine has a molecular weight of 432.52 g/mol, XLogP of 5.86, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)-N-[4-(2-methoxyphenoxy)phenyl]methanimine is sourced from PubChem (CID 126111922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).