C19H19Cl2N3O2 — CID 126114950
2,4-dichloro-N-[(Z)-(2-methyl-4-morpholin-4-ylphenyl)methylideneamino]benzamide (PubChem CID 126114950) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-(2-methyl-4-morpholin-4-ylphenyl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-(2-methyl-4-morpholin-4-ylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126114950 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-(2-methyl-4-morpholin-4-ylphenyl)methylideneamino]benzamide |
| SMILES | Cc1cc(N2CCOCC2)ccc1/C=N\NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-13-10-16(24-6-8-26-9-7-24)4-2-14(13)12-22-23-19(25)17-5-3-15(20)11-18(17)21/h2-5,10-12H,6-9H2,1H3,(H,23,25)/b22-12- |
| InChIKey | XSVSOIDEKFILOR-UUYOSTAYSA-N |
| XLogP | 3.90 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|