C19H19BrFN3O2 — CID 19061673
2-(4-bromophenyl)-N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]acetamide (PubChem CID 19061673) has the molecular formula C19H19BrFN3O2 and a molecular weight of 420.28 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19061673 |
| Molecular Formula | C19H19BrFN3O2 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(E)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)N/N=C/c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C19H19BrFN3O2/c20-16-4-1-14(2-5-16)12-19(25)23-22-13-15-3-6-18(17(21)11-15)24-7-9-26-10-8-24/h1-6,11,13H,7-10,12H2,(H,23,25)/b22-13+ |
| InChIKey | WWHZKKPANODDED-LPYMAVHISA-N |
| XLogP | 3.12 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|