C16H13Br3N2O — CID 19061362
2-(4-bromophenyl)-N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide (PubChem CID 19061362) has the molecular formula C16H13Br3N2O and a molecular weight of 489.01 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19061362 |
| Molecular Formula | C16H13Br3N2O |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 485.86 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1c(Br)cc(/C=N\NC(=O)Cc2ccc(Br)cc2)cc1Br |
| InChI | InChI=1S/C16H13Br3N2O/c1-10-14(18)6-12(7-15(10)19)9-20-21-16(22)8-11-2-4-13(17)5-3-11/h2-7,9H,8H2,1H3,(H,21,22)/b20-9- |
| InChIKey | JTKTYMUREKIWLA-UKWGHVSLSA-N |
| XLogP | 4.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|