C18H18Br2N2O — CID 3345435
N-[(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(3,4-dimethylphenyl)acetamide (PubChem CID 3345435) has the molecular formula C18H18Br2N2O and a molecular weight of 438.16 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(3,4-dimethylphenyl)acetamide.
| Compound Name | N-[(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 3345435 |
| Molecular Formula | C18H18Br2N2O |
| Molecular Weight | 438.16 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | N-[(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)NN=Cc2cc(Br)c(C)c(Br)c2)cc1C |
| InChI | InChI=1S/C18H18Br2N2O/c1-11-4-5-14(6-12(11)2)9-18(23)22-21-10-15-7-16(19)13(3)17(20)8-15/h4-8,10H,9H2,1-3H3,(H,22,23) |
| InChIKey | VDZVKXOLKBGQLZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.16 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|