C16H20N4O5S2 — CID 26950907
N'-(4-methoxyphenyl)sulfonyl-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 26950907) has the molecular formula C16H20N4O5S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N'-(4-methoxyphenyl)sulfonyl-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(4-methoxyphenyl)sulfonyl-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26950907 |
| Molecular Formula | C16H20N4O5S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N'-(4-methoxyphenyl)sulfonyl-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | COc1ccc(S(=O)(=O)NNC(=O)c2sc(N3CCOCC3)nc2C)cc1 |
| InChI | InChI=1S/C16H20N4O5S2/c1-11-14(26-16(17-11)20-7-9-25-10-8-20)15(21)18-19-27(22,23)13-5-3-12(24-2)4-6-13/h3-6,19H,7-10H2,1-2H3,(H,18,21) |
| InChIKey | PJAOZDAGULHAHJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|