C13H16N4O4S3 — CID 26950906
4-methyl-2-morpholin-4-yl-N'-thiophen-2-ylsulfonyl-1,3-thiazole-5-carbohydrazide (PubChem CID 26950906) has the molecular formula C13H16N4O4S3 and a molecular weight of 388.50 g/mol. Its IUPAC name is 4-methyl-2-morpholin-4-yl-N'-thiophen-2-ylsulfonyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-morpholin-4-yl-N'-thiophen-2-ylsulfonyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26950906 |
| Molecular Formula | C13H16N4O4S3 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 4-methyl-2-morpholin-4-yl-N'-thiophen-2-ylsulfonyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H16N4O4S3/c1-9-11(23-13(14-9)17-4-6-21-7-5-17)12(18)15-16-24(19,20)10-3-2-8-22-10/h2-3,8,16H,4-7H2,1H3,(H,15,18) |
| InChIKey | AIWVOPPZEFTYHC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|