C15H18N4O4S — CID 25444482
4-methyl-N'-(5-methylfuran-2-carbonyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 25444482) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-methyl-N'-(5-methylfuran-2-carbonyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-(5-methylfuran-2-carbonyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 25444482 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-methyl-N'-(5-methylfuran-2-carbonyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2sc(N3CCOCC3)nc2C)o1 |
| InChI | InChI=1S/C15H18N4O4S/c1-9-3-4-11(23-9)13(20)17-18-14(21)12-10(2)16-15(24-12)19-5-7-22-8-6-19/h3-4H,5-8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | ARCIYUXSECHUGA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|