C14H16N4O3S2 — CID 25446747
4-methyl-2-morpholin-4-yl-N'-(thiophene-3-carbonyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 25446747) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 4-methyl-2-morpholin-4-yl-N'-(thiophene-3-carbonyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-morpholin-4-yl-N'-(thiophene-3-carbonyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 25446747 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 4-methyl-2-morpholin-4-yl-N'-(thiophene-3-carbonyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1ccsc1 |
| InChI | InChI=1S/C14H16N4O3S2/c1-9-11(23-14(15-9)18-3-5-21-6-4-18)13(20)17-16-12(19)10-2-7-22-8-10/h2,7-8H,3-6H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | NKGHURNKWJXKEX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|