C16H18N6O5S — CID 46656827
N'-(4-amino-3-nitrobenzoyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 46656827) has the molecular formula C16H18N6O5S and a molecular weight of 406.42 g/mol. Its IUPAC name is N'-(4-amino-3-nitrobenzoyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(4-amino-3-nitrobenzoyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 46656827 |
| Molecular Formula | C16H18N6O5S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N'-(4-amino-3-nitrobenzoyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N6O5S/c1-9-13(28-16(18-9)21-4-6-27-7-5-21)15(24)20-19-14(23)10-2-3-11(17)12(8-10)22(25)26/h2-3,8H,4-7,17H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | ZABLSSYCLMBCIS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|