C21H23N5O3S2 — CID 39912237
2-benzyl-4-methyl-N'-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 39912237) has the molecular formula C21H23N5O3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-benzyl-4-methyl-N'-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-benzyl-4-methyl-N'-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 39912237 |
| Molecular Formula | C21H23N5O3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-benzyl-4-methyl-N'-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(Cc2ccccc2)sc1C(=O)NNC(=O)c1sc(N2CCOCC2)nc1C |
| InChI | InChI=1S/C21H23N5O3S2/c1-13-17(30-16(22-13)12-15-6-4-3-5-7-15)19(27)24-25-20(28)18-14(2)23-21(31-18)26-8-10-29-11-9-26/h3-7H,8-12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | GICBUFNAFSONMK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|