C23H21N5O4S2 — CID 36757551
N'-[2-(furan-2-yl)-4-phenyl-1,3-thiazole-5-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 36757551) has the molecular formula C23H21N5O4S2 and a molecular weight of 495.59 g/mol. Its IUPAC name is N'-[2-(furan-2-yl)-4-phenyl-1,3-thiazole-5-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-(furan-2-yl)-4-phenyl-1,3-thiazole-5-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 36757551 |
| Molecular Formula | C23H21N5O4S2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N'-[2-(furan-2-yl)-4-phenyl-1,3-thiazole-5-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1sc(-c2ccco2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H21N5O4S2/c1-14-18(34-23(24-14)28-9-12-31-13-10-28)20(29)26-27-21(30)19-17(15-6-3-2-4-7-15)25-22(33-19)16-8-5-11-32-16/h2-8,11H,9-10,12-13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | HXVDALUPOFAMNY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|