C18H16N2O3S — CID 36704275
[2-(furan-2-yl)-4-phenyl-1,3-thiazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 36704275) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is [2-(furan-2-yl)-4-phenyl-1,3-thiazol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(furan-2-yl)-4-phenyl-1,3-thiazol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 36704275 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-(furan-2-yl)-4-phenyl-1,3-thiazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1sc(-c2ccco2)nc1-c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H16N2O3S/c21-18(20-8-11-22-12-9-20)16-15(13-5-2-1-3-6-13)19-17(24-16)14-7-4-10-23-14/h1-7,10H,8-9,11-12H2 |
| InChIKey | PJLVEUDQVWKBFQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |