C20H14N2O3S — CID 36766447
2-(furan-2-yl)-N-(2-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 36766447) has the molecular formula C20H14N2O3S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-(2-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(furan-2-yl)-N-(2-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 36766447 |
| Molecular Formula | C20H14N2O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-(furan-2-yl)-N-(2-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1sc(-c2ccco2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H14N2O3S/c23-15-10-5-4-9-14(15)21-19(24)18-17(13-7-2-1-3-8-13)22-20(26-18)16-11-6-12-25-16/h1-12,23H,(H,21,24) |
| InChIKey | XZWAXJOVPHLAKC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|