C14H10N2O4 — CID 24739268
5-(furan-2-yl)-N-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 24739268) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24739268 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-(furan-2-yl)-N-(2-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C14H10N2O4/c17-11-5-2-1-4-9(11)15-14(18)10-8-13(20-16-10)12-6-3-7-19-12/h1-8,17H,(H,15,18) |
| InChIKey | OKRMASWODOJQHG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|