5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride

C8H4ClNO3 — CID 2795555

IUPAC5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride
SMILESO=C(Cl)c1cc(-c2ccco2)on1
InChIInChI=1S/C8H4ClNO3/c9-8(11)5-4-7(13-10-5)6-2-1-3-12-6/h1-4H
InChIKeyRCDNHOYZXMTBMF-UHFFFAOYSA-N
MW197.58 g/mol
LogP2.31
Rot. Bonds2

About 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride

5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride (PubChem CID 2795555) has the molecular formula C8H4ClNO3 and a molecular weight of 197.58 g/mol. Its IUPAC name is 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride.

Molecular Properties

Compound Name5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride
PubChem CID2795555
Molecular FormulaC8H4ClNO3
Molecular Weight197.58 g/mol
Exact Mass196.99
IUPAC Name5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride
SMILESO=C(Cl)c1cc(-c2ccco2)on1
InChIInChI=1S/C8H4ClNO3/c9-8(11)5-4-7(13-10-5)6-2-1-3-12-6/h1-4H
InChIKeyRCDNHOYZXMTBMF-UHFFFAOYSA-N
XLogP2.31
TPSA56.24 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.58
LogP ≤ 52.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride?
The IUPAC name of 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride (CID 2795555) is 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride.
What is the SMILES notation for 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride?
The canonical SMILES for 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride is O=C(Cl)c1cc(-c2ccco2)on1.
What is the InChIKey of 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride?
The InChIKey is RCDNHOYZXMTBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClNO3/c9-8(11)5-4-7(13-10-5)6-2-1-3-12-6/h1-4H.
What are the key properties of 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride?
5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride has a molecular weight of 197.58 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride is sourced from PubChem (CID 2795555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).