C8H4ClNO3 — CID 2795555
5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride (PubChem CID 2795555) has the molecular formula C8H4ClNO3 and a molecular weight of 197.58 g/mol. Its IUPAC name is 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride.
| Compound Name | 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 2795555 |
| Molecular Formula | C8H4ClNO3 |
| Molecular Weight | 197.58 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 5-(furan-2-yl)-1,2-oxazole-3-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C8H4ClNO3/c9-8(11)5-4-7(13-10-5)6-2-1-3-12-6/h1-4H |
| InChIKey | RCDNHOYZXMTBMF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|