C9H7ClN2O3 — CID 13376511
2-chloro-N-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetamide (PubChem CID 13376511) has the molecular formula C9H7ClN2O3 and a molecular weight of 226.62 g/mol. Its IUPAC name is 2-chloro-N-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetamide.
| Compound Name | 2-chloro-N-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetamide |
|---|---|
| PubChem CID | 13376511 |
| Molecular Formula | C9H7ClN2O3 |
| Molecular Weight | 226.62 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-chloro-N-[5-(furan-2-yl)-1,2-oxazol-3-yl]acetamide |
| SMILES | O=C(CCl)Nc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C9H7ClN2O3/c10-5-9(13)11-8-4-7(15-12-8)6-2-1-3-14-6/h1-4H,5H2,(H,11,12,13) |
| InChIKey | MGIUQKIDRGWJSW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|