C13H10N2O2 — CID 71761719
5-(furan-2-yl)-N-phenyl-1,2-oxazol-3-amine (PubChem CID 71761719) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-phenyl-1,2-oxazol-3-amine.
| Compound Name | 5-(furan-2-yl)-N-phenyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 71761719 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 5-(furan-2-yl)-N-phenyl-1,2-oxazol-3-amine |
| SMILES | c1ccc(Nc2cc(-c3ccco3)on2)cc1 |
| InChI | InChI=1S/C13H10N2O2/c1-2-5-10(6-3-1)14-13-9-12(17-15-13)11-7-4-8-16-11/h1-9H,(H,14,15) |
| InChIKey | GCESGULDVUNVDU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |