C19H17N7O3 — CID 122289324
5-(furan-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 122289324) has the molecular formula C19H17N7O3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122289324 |
| Molecular Formula | C19H17N7O3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCNc1ccc(Nc2cccnc2)nn1)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C19H17N7O3/c27-19(14-11-16(29-26-14)15-4-2-10-28-15)22-9-8-21-17-5-6-18(25-24-17)23-13-3-1-7-20-12-13/h1-7,10-12H,8-9H2,(H,21,24)(H,22,27)(H,23,25) |
| InChIKey | TXVZGQHQUWFRBM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|