C21H21N7O — CID 121066481
2-(1H-indol-3-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide (PubChem CID 121066481) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 121066481 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NCCNc1ccc(Nc2cccnc2)nn1 |
| InChI | InChI=1S/C21H21N7O/c29-21(12-15-13-25-18-6-2-1-5-17(15)18)24-11-10-23-19-7-8-20(28-27-19)26-16-4-3-9-22-14-16/h1-9,13-14,25H,10-12H2,(H,23,27)(H,24,29)(H,26,28) |
| InChIKey | GOACATBYDMPHEU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|