C18H17ClN6O — CID 121066456
4-chloro-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]benzamide (PubChem CID 121066456) has the molecular formula C18H17ClN6O and a molecular weight of 368.83 g/mol. Its IUPAC name is 4-chloro-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121066456 |
| Molecular Formula | C18H17ClN6O |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-chloro-N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1ccc(Nc2cccnc2)nn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN6O/c19-14-5-3-13(4-6-14)18(26)22-11-10-21-16-7-8-17(25-24-16)23-15-2-1-9-20-12-15/h1-9,12H,10-11H2,(H,21,24)(H,22,26)(H,23,25) |
| InChIKey | GDANHPPDEOEAEH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|