C15H18N6O — CID 122289299
N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 122289299) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 122289299 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[2-[[6-(pyridin-3-ylamino)pyridazin-3-yl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNc1ccc(Nc2cccnc2)nn1)C1CC1 |
| InChI | InChI=1S/C15H18N6O/c22-15(11-3-4-11)18-9-8-17-13-5-6-14(21-20-13)19-12-2-1-7-16-10-12/h1-2,5-7,10-11H,3-4,8-9H2,(H,17,20)(H,18,22)(H,19,21) |
| InChIKey | AEFXMFZVGCIBCJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|